| Cas No.: | 872506-67-7 |
| Chemical Name: | (3s)-1-[(3-chloro-2-methylphenyl)sulfonyl]-n-cyclohexyl-3-piperid Inecarboxamide |
| Synonyms: | (3s)-1-[(3-chloro-2-methylphenyl)sulfonyl]-n-cyclohexyl-3-piperid Inecarboxamide |
| SMILES: | C1CCC(NC(C2CCCN(S(C3C=CC=C(Cl)C=3C)(=O)=O)C2)=O)CC1 |
| Formula: | C19H27N2O3Scl |
| M.Wt: | 398.94728 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | INCB13739 (INCB-13739) is a potent, selective, oral 11βHSD1 inhibitor (IC50=1.1 nM) with high seelctivity over other dehydrogenases, glucocorticoid and mineralocorticoid receptors. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
