| Cas No.: | 1940118-04-6 |
| Chemical Name: | 2-(7-Methylimidazo[1,2-a]pyridin-6-yl)-N-(2-phenyl-2-(pyridin-4-yl)ethyl)quinazolin-4-amine |
| Synonyms: | SRI31142 |
| SMILES: | N1=C2C(C=CC=C2)=C(NCC(C2=CC=CC=C2)C2C=CN=CC=2)N=C1C1=CN2C=CN=C2C=C1C |
| M.Wt: | 456.553 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SRI-31142 (SRI31142) is a novel potent, putative allosteric dopamine transporter (DAT) inhibitor with Ki of 1.9 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
