| Cas No.: | 1160852-22-1 |
| Chemical Name: | N-(3-(diethylamino)propyl)-7-oxo-7H-dibenzo[de,g]quinoline-4-carboxamide |
| Synonyms: | ATG4B inhibitor S130 |
| SMILES: | N1C2=C3C(=CC=CC3=C(C(NCCCN(CC)CC)=O)C=1)C1=CC=CC=C1C2=O |
| Formula: | C24H25N3O2 |
| M.Wt: | 387.483 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | S130 (ATG4B inhibitor S130) is a potent, specific ATG4B inhibitor with IC50 of 3.24 uM, shows strong affinity (Kd=4 uM) and specifically suppresses the activity of ATG4B, but not other proteases; displays no inhibitory effects on cysteine proteases such as CASP3 (caspase 3), CASP8 (caspase 8) and CASP9 (caspase 9), or aspartic proteases; does not cause the impairment of autophagosome fusion, nor does it result in the dysfunction of lysosomes; causes cell death of colorectal cancer cells in vitro and in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
