| Cas No.: | 82564-18-9 |
| Chemical Name: | L-Tyrosinamide, N2-(4-methoxy-1,4-dioxobutyl)-L-arginyl-L-prolyl-N-(4-nitrophenyl)- |
| Synonyms: | L-Tyrosinamide, N2-(4-methoxy-1,4-dioxobutyl)-L-arginyl-L-prolyl-N-(4-nitrophenyl)- |
| SMILES: | C(N)(=O)[C@H](CC1=CC=C(O)C=C1)N(C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)CCC(OC)=O)C1=CC=C([N+]([O-])=O)C=C1 |
| Formula: | C31H40N8O9 |
| M.Wt: | 668.697506904602 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | S-2222 is chromogenic substrate for factor Xa. When catalyzed by factor Xa, it releases a free pNA which could be detected by a spectrophotometer at 405 nm wavelength.Chromogenic substrate S-2222 can be used in many applications. For example, it is a key |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
