| Cas No.: | 1374248-81-3 |
| Chemical Name: | (3'S)-N-[(3S,5S,6R)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2'-oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-3-carboxamide |
| Synonyms: | MK-8031;AGN-241689 |
| SMILES: | C12C[C@]3(C(=O)NC4=NC=CC=C43)CC1=CC(C(N[C@@H]1C[C@H](C3=C(F)C=CC(F)=C3F)[C@H](C)N(CC(F)(F)F)C1=O)=O)=CN=2 |
| Formula: | C29H23F6N5O3 |
| M.Wt: | 603.525 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective and orally available CGRP receptor antagonist for the prevention of migraine. Migraine |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
