To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1371587-51-7 |
| Chemical Name: | 3-Chloro-4-(6-hydroxy-2-quinolinyl)benzoic acid |
| Synonyms: | N91115;N-91115 |
| SMILES: | C(O)(=O)C1=CC=C(C2C=CC3C(N=2)=CC=C(O)C=3)C(Cl)=C1 |
| Formula: | C16H10ClNO3 |
| M.Wt: | 299.71 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, orally bioavailable inhibitor of S-nitrosoglutathione reductase (GSNOR) and CFTR modulator; promotes CFTR maturation and plasma membrane stability, with a mechanism of action complementary to CFTR correctors and potentiators; significantly increases cell surface expression of F508del-CFTR in vitro combined with CFTR correctors. |