To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1801749-44-9 |
| Chemical Name: | (R)-2,2-dimethyl-4-(3-(3-(3-(methylamino)phenyl)ureido)-2-oxo-5-(pyridin-2-yl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-1-yl)-3-oxobutyl acetate |
| SMILES: | C(OCC(C)(C)C(=O)CN1C2=CC=CC=C2C(C2=NC=CC=C2)=N[C@H](NC(NC2=CC=CC(NC)=C2)=O)C1=O)(=O)C |
| Formula: | C30H32N6O5 |
| M.Wt: | 556.623 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective cholecystokinin receptor CCK2 antagonist for treatment of gastroesophageal reflux disease (GERD). |