| Cas No.: | 1421332-97-9 |
| Chemical Name: | Benzoic acid, 4-[[(1S,2S)-2,3-dihydro-1-hydroxy[2,2'-bi-1H-inden]-2-yl]methyl]- |
| Synonyms: | PH 46A;PH46A |
| SMILES: | C(O)(=O)C1=CC=C(C[C@@](C2=CC3=C(C2)C=CC=C3)2CC3=C([C@@H]2O)C=CC=C3)C=C1 |
| Formula: | C27H24O3 |
| M.Wt: | 396.48 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, first-in-class, oral small-molecule agent for the treatment of inflammatory bowel diseases. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
