To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2166091-48-9 |
| Chemical Name: | (1R,3S)-3-amino-N-(3-(naphthalen-1-ylamino)-1H-indazol-5-yl)cyclohexane-1-carboxamide |
| Synonyms: | SR 20295;SR20295 |
| SMILES: | [C@@H](C(NC1C=CC2=C(C=1)C(NC1=C3C(C=CC=C3)=CC=C1)=NN2)=O)1CCC[C@@H](N)C1 |
| Formula: | C24H25N5O |
| M.Wt: | 399.498 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SR-20295 (SR20295) is a novel potent ULK1 inhibitor with IC50 of 45 nM. |
