| Cas No.: | 2134571-29-0 |
| Chemical Name: | (5-(4-fluorobenzyl)-2,4-dihydroxyphenyl)(isoindolin-2-yl)methanone |
| Synonyms: | KUNG-94;KUNG 94 |
| SMILES: | C(C1=CC(CC2=CC=C(F)C=C2)=C(O)C=C1O)(N1CC2=C(C1)C=CC=C2)=O |
| Formula: | C22H18FNO3 |
| M.Wt: | 363.388 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective Grp94 inhibitor with IC50 of 8 nM; displays 10-fold selecticity over Hsp90α; shows antiproliferative activity against RPMI8226 cells with Gi50 of 1.4 uM, reduces LRP6 levels and induces apoptosis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
