| Cas No.: | 862281-92-3 |
| Chemical Name: | [(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-3-yl]-[(3S,5R)-4-hydroxy-3,5-dimethyl-4-phenylpiperidin-1-yl]methanone |
| Synonyms: | PF-446687;PF00446687 |
| SMILES: | C([C@@H]1[C@@H](C2=CC=C(F)C=C2F)CN(C(C)(C)C)C1)(N1C[C@H](C)C(O)(C2=CC=CC=C2)[C@H](C)C1)=O |
| Formula: | C28H36F2N2O2 |
| M.Wt: | 470.593 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PF-00446687(PF-446687) is a potent, selective melanocortin-4 receptor (MC4R) agonist with EC50 of 12 nM; displays >100-fold selectivity over MC1R/1 uM); is find to be active in preliminary human trials, with the 200mg dose being of similar effectiveness to 100mg sildenafil, though lower doses were ineffective. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
