To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1200129-48-1 |
| Chemical Name: | 5-((1-ethylpiperidin-4-yl)oxy)-9H-pyrrolo[2,3-b:5,4-c']dipyridine-6-carbonitrile |
| Synonyms: | RG-7602;RG7602;GDC0425 |
| SMILES: | C12NC3C(C1=CC=CN=2)=C(OC1CCN(CC)CC1)C(C#N)=NC=3 |
| Formula: | C18H19N5O |
| M.Wt: | 321.384 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective and orally active Chk1 inhibitor; enhances gemcitabine efficacy in tumor xenograft models; shows greater chemopotentiation in cancer cell lines lacking p53 activity. |