To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 631864-00-1 |
| Chemical Name: | 1-[2-(3-aminopropoxy)phenyl]-3-pyrazin-2-ylurea |
| Synonyms: | EXEL-9844;EXEL9844;XL844 |
| SMILES: | N(C1=CC=CC=C1OCCCN)C(NC1=NC=CN=C1)=O |
| Formula: | C14H17N5O2 |
| M.Wt: | 287.323 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, specific, orally available, ATP‑competitive inhibitor of Chk1 and Chk2 with Ki of 2.2 nM and 0.07 nM, respectively; increases gemcitabine-induced H2AX phosphorylation, blocks Cdc25A phosphorylation, and induces premature mitotic entry; significantly enhances gemcitabine antitumor activity in a PANC-1 xenograft model. |