To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1243324-08-4 |
| Chemical Name: | 1-((5-(aminomethyl)-1-isopentyl-1H-benzo[d]imidazol-2-yl)methyl)-3-cyclopropyl-3,4-dihydroquinazolin-2(1H)-one |
| Synonyms: | AZD 4316;AZD4316 |
| SMILES: | N(CC1=NC2=CC(CN)=CC=C2N1CCC(C)C)1C2=C(C=CC=C2)CN(C2CC2)C1=O |
| Formula: | C25H31N5O |
| M.Wt: | 417.557 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent respiratory syncytial virus (RSV) fusion inhibitor. |
