| Cas No.: | 1207753-03-4 |
| Chemical Name: | (1S,2R,3R,4aR,6aS,7R,8R,10aR,10bR,12aR)-2-((R)-2-amino-2,3,3-trimethylbutoxy)-1,6a,8,10a-tetramethyl-8-((R)-3-methylbutan-2-yl)-3-(5-(pyridin-4-yl)-1H-1,2,4-triazol-1-yl)-1,3,4,6,6a,7,8,9,10,10a,10b,11,12,12a-tetradecahydro-2H-1,4a-(methanooxymethano)chry |
| Synonyms: | MK-3118;MK 3118;SCY 078 |
| SMILES: | C[C@H](C(C)C)[C@]1(CC[C@@]2([C@H]3CC[C@H]4[C@]5(COC[C@]4(C3=CC[C@]2([C@@H]1C(=O)O)C)C[C@H]([C@@H]5OC[C@@](C)(C(C)(C)C)N)N6C(=NC=N6)C7=CC=NC=C7)C)C)C |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel orally bioavailable fungal beta-1,3-D glucan synthetase inhibitor against Candida species C. glabrata (MIC 0.03 to 0.25 ug/ml), C. parapsilosis (MIC 0.06 to 0.25 ug/ml); shows actvity in an in vivo neutropenic murine model. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
