| Cas No.: | 936487-67-1 |
| Chemical Name: | (4-oxo-4-((4-(4-oxo-8-phenyl-4H-chromen-2-yl)morpholino-4-ium)methoxy)butanoyl)-L-arginylglycyl-L-aspartyl-L-serinate |
| Synonyms: | SF 1126;SF1126 |
| SMILES: | C(O)(=O)[C@@H](CO)NC(=O)[C@@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](CCCNC(N)=N)NC(=O)CCC(=O)OC[N+](C1OC2=C(C=CC=C2C2=CC=CC=C2)C(=O)C=1)1CCOCC1 |
| Formula: | C39H48N8O14 |
| M.Wt: | 852.843620000001 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SF-1126 is a pan PI3K/BRD4 inhibitor, RGDS-conjugated LY294002 prodrug that exhibits increased solubility and binds to specific integrins; blocks expression levels of c-Myc in HCC cells, inhibits proliferation, cell cycle, apoptosis, PI3K/AKT/mTOR and Ras/Raf/MAPK pathway; shows significant antitumor activity in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
