To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | |
| Chemical Name: | tert-butyl (E)-4-(2-(3-(3-chlorophenyl)acrylamido)-N-methylacetamido)piperidine-1-carboxylate |
| Synonyms: | YD 277;YD277 |
| SMILES: | N(C(OC(C)(C)C)=O)1CCC(N(C)C(=O)CNC(=O)/C=C/C2=CC=CC(Cl)=C2)CC1 |
| Formula: | C22H30ClN3O4 |
| M.Wt: | 435.949 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel small molecule KLF5 inhibitor derived from ML264, demonstrates >10-fold enhanced efficacy in multiple cancer cell lines with IC50 of 1.5-10 uM; decreases cancer cell viability in a KLF5-independent manner, induces G1 cell cycle arrest and promotes apoptosis through activating IRE1α in MDA-MB-231 and MDA-MB-468 cells; significantly inhibits the growth of MDA-MB-231 tumor xenografts in nude mice. |