| Cas No.: | 949588-40-3 |
| Chemical Name: | cis-N-methyl-N-(6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl methyl)amino methylcarboxylic acid |
| Synonyms: | Org25935;Org-25935;SCH 900435 |
| SMILES: | C(N(C)C[C@@H]1CCC2=C([C@@H]1C1=CC=CC=C1)C=CC(OC)=C2)C(O)=O |
| Formula: | C21H25NO3.HCl |
| M.Wt: | 375.88904 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective glycine transporter 1 (GlyT1) inhibitor with IC50 of 100 nM; shows negligible action on GlyT2; produces a robust and dose-dependent decrease in EtOH consumption in rats, reduces compulsive relapse-like drinking without the development of tolerance. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
