| Cas No.: | 1802706-04-2 |
| Chemical Name: | (S)-N-((5-(ethylsulfonyl)pyridin-2-yl)methyl)-7-isopropyl-6-(((1r,4S)-4-(trifluoromethyl)cyclohexyl)methyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine-3-carboxamide |
| Synonyms: | VTP 43742;VTP43742) |
| SMILES: | C12[C@@H](C(C)C)N(C[C@H]3CC[C@H](C(F)(F)F)CC3)CC1=CC(C(NCC1=NC=C(S(CC)(=O)=O)C=C1)=O)=CN=2 |
| Formula: | C27H35F3N4O3S |
| M.Wt: | 552.652015924454 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | VTP-43742 (VTP43742) is a highly potent, selective, oral RORγt inverse agonist for the treatment of autoimmune disorders, including multiple sclerosis and psoriasis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
