| Cas No.: | 238750-81-7 |
| Chemical Name: | cyclopentyl (2S)-2-[[(2R)-2-[(1S)-2-(hydroxyamino)-1-methoxy-2-oxoethyl]-4-methylpentanoyl]amino]-2-phenylacetate |
| Synonyms: | CHR2863;CHR-2863 |
| SMILES: | C(OC1CCCC1)(=O)[C@H](NC(=O)[C@H]([C@@H](OC)C(NO)=O)CC(C)C)C1=CC=CC=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, orally available hydrophobic aminopeptidase inhibitor that structurally mimics the aminopeptidase inhibitor Tostedostat. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
