| Cas No.: | 2108830-09-5 |
| Chemical Name: | 2-(5-(4-((phenethyl(4-(4-(pyrrolidin-1-ylmethyl)phenoxy)butyl)amino)methyl)phenyl)-2H-tetrazol-2-yl)acetic acid dihydrochloride |
| Synonyms: | TH-1834;TH 1834 |
| SMILES: | C(O)(=O)CN1N=NC(C2=CC=C(CN(CCC3=CC=CC=C3)CCCCOC3=CC=C(CN4CCCC4)C=C3)C=C2)=N1.[H]Cl.[H]Cl |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent specific histone acetyltransferaseTip60 inhibitor; induces apoptosis in breast cancer cell lines with more cytotoxicity than staurosporine; increases the γH2AX foci in the cancer cell lines PC-3 and DU-145 combined with IR; induces apoptosis and increases unrepaired DNA damage in breast cancer cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
