| Cas No.: | 357649-93-5 |
| Chemical Name: | N-[4-(4-Chloro-phenyl)-thiazol-2-yl]-N'-cyclopentylidene-hydrazine |
| SMILES: | N(C1=NC(C2=CC=C(Cl)C=C2)=CS1)/N=C1\CCCC\1 |
| Formula: | C14H14ClN3S |
| M.Wt: | 291.797 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CPTH2 is a specific histone acetyltransferase inhibitor modulating Gcn5 network in vitro and in vivo, inhibits H3 acetylation and induces cell-cycle perturbation and apoptosis in U-937 cells; increases E1A CR3 transactivation of human adenovirus through inhibition of HAT GCN5, also reduces virus yield during infection; induces apoptosis and decreases the invasiveness of a ccRCC cell line through the inhibition of KAT3B. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
