| Cas No.: | 256497-58-2 |
| Chemical Name: | (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-1,8b-dihydroxy-N,6,8-trimethoxy-3-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2-carboxamide |
| Synonyms: | CMLD 010509;SDS-1-021 |
| SMILES: | O1C2=CC(OC)=CC(OC)=C2[C@](O)2[C@@H](O)[C@@H](C(NOC)=O)[C@H](C3=CC=CC=C3)[C@@]12C1=CC=C(Br)C=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A rocaglate (flavagline) derivative that acts a highly specific inhibitor of the oncogenic translation program supporting MM, including key oncoproteins such as MYC, MDM2, CCND1, MAF, and MCL-1; induces apoptosis and inhibits the heat shock response in MM cells (IC50=10 nM), a potent and selective translation inhibitor through an eIF4E phosphorylation-independent mechanism and is highly effective in vivo in several mouse models. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
