| Cas No.: | 236095-29-7 |
| Chemical Name: | (8R,10S)-10-(((2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-6,8,11-trihydroxy-8-(2-hydroxyethyl)-12-imino-1-methoxy-7,9,10,12-tetrahydrotetracen-5(8H)-one |
| Synonyms: | GPX 150;CNDO-101;DIDOX;5-imino-13-deoxy-doxorubicin |
| SMILES: | C1=CC2C(=O)C3=C(O)C4C[C@](O)(CCO)C[C@@H](O[C@H]5O[C@H](C)[C@@H](O)[C@H](N)C5)C=4C(O)=C3C(=N)C=2C(OC)=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A doxorubicin analog that demonstrates anti-cancer activity without cardiotoxicity, does not inhibit topoisomerase IIβ activity at 100 uM |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
