| Cas No.: | 1333218-50-0 |
| Chemical Name: | Upacicalcet |
| Synonyms: | Upacicalcet;5C1222PBE2;(2S)-2-amino-3-{[(3-chloro-2-methyl-5-sulfophenyl)carbamoyl]amino}propanoic acid;(2S)-2-Amino-3-(((3-chloro-2-methyl-5-sulfophenyl)carbamoyl)amino)propanoic acid;Upacicalcet [INN];L-Alanine, 3-((((3-chloro-2-methyl-5-sulfophenyl)amino)carbonyl)amino)-;(2S)-2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid |
| SMILES: | ClC1=CC(=CC(=C1C)NC(NC[C@@H](C(=O)O)N)=O)S(=O)(=O)O |
| Formula: | C11H14ClN3O6S |
| M.Wt: | 351.763360500336 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Upacicalcet is an intravenous calcimimetic agent. Upacicalcet suppresses excessive parathyroid hormone (PTH) secretion, thereby lowering blood PTH levels, by acting directly on parathyroid cell membrane calcium-sensing receptors. Upacicalcet can be used for researching the disease of secondary hyperparathyroidism (SHPT). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
