| Cas No.: | 1638750-95-4 |
| Chemical Name: | ADU-S100 disodium salt |
| Synonyms: | FMW9ZVF53N;MIW815;ADU S100 [WHO-DD];Unii-fmw9zvf53N;MIW815 disodium salt;ML RR-S2 CDA disodium salt;ADU-S100 disodium salt |
| SMILES: | S=P1([O-])OC[C@@H]2[C@H]([C@H]([C@H](N3C=NC4C(N)=NC=NC3=4)O2)O)OP([O-])(OC[C@@H]2[C@H]([C@H]([C@H](N3C=NC4C(N)=NC=NC3=4)O2)O1)O)=S.[Na+].[Na+] |
| Formula: | C20H22N10Na2O10P2S2 |
| M.Wt: | 734.506742954254 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ADU-S100 (MIW815) is a synthetic cyclic dinucleotide agonist of STING, elicits potent and durable anti-tumor immunity when administered IT in pre-clinical syngeneic tumor models. Blood Cancer Phase 1 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
