| Cas No.: | 1242087-93-9 |
| Chemical Name: | Methyl N-[(2S)-1-{(2S)-2-[5-(6-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}pyrrolidin-2-yl]-1H-imidazol-4-yl}naphthalen-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl}-3-methyl-1-oxobutan-2-yl]carbamate |
| Synonyms: | PPI-668;BI 238630 |
| SMILES: | CC(C)[C@@H](C(=O)N1CCC[C@H]1C2=NC3=C(N2)C=C(C=C3)C4=CC5=C(C=C4)C=C(C=C5)C6=CN=C(N6)[C@@H]7CCCN7C(=O)[C@H](C(C)C)NC(=O)OC)NC(=O)OC |
| Formula: | C42H50N8O6 |
| M.Wt: | 762.91 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Ravidasvir (PPI-668;BI 238630) is a potent pan-genotypic HCV NS5A inhibitor with IC50 of 0.12/0.01/1.14 nM for HCV gt-1a/1b/3a in replicon luciferase assay; |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
