| Cas No.: | 339304-10-8 |
| Chemical Name: | 339304-10-8 (Free acid) |
| Synonyms: | Sodium (R,E)-2-(2-(2-(4-isopropylbenzylidene)hydrazineyl)-4-oxo-4,5-dihydrothiazol-5-yl)acetate;339304-10-8 (Free acid) |
| SMILES: | S1C(=N/N=C(/[H])\C2C([H])=C([H])C(=C([H])C=2[H])C([H])(C([H])([H])[H])C([H])([H])[H])N([H])C([C@@]1([H])C([H])([H])C(=O)[O-])=O.[Na+] |
| Formula: | C15H16N3NaO3S |
| M.Wt: | 341.3606 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | VPC-18005 (VPC18005) is a novel small molecule ERG (ETS-related gene) antagonist that inhibits ERG-induced transcription and interacts directly with the ERG-ETS domain, disrupts the ERG binding to DNA (Kd=250 uM); markedly decreases SOX9 expression, inhibits migration and invasion of ERG-overexpressing prostate cancer cells in vitro, and reduces metastasis in a zebrafish xenograft model. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
