| Cas No.: | 1801530-11-9 |
| Chemical Name: | Imidazole ketone erastin |
| Synonyms: | Imidazole ketone erastin;IKE;Imidazole ketone erastinIKE;ZB1594;BDBM50126162;s8877;3-(5-(2-(1H-imidazol-1-yl)acetyl)-2-isopropoxyphenyl)-2-((4-(2-(4-chlorophenoxy)acetyl)piperazin-1-yl)methyl)quinazolin-4(3H)-one |
| SMILES: | ClC1C([H])=C([H])C(=C([H])C=1[H])OC([H])([H])C(N1C([H])([H])C([H])([H])N(C([H])([H])C2=NC3=C([H])C([H])=C([H])C([H])=C3C(N2C2C([H])=C(C(C([H])([H])N3C([H])=NC([H])=C3[H])=O)C([H])=C([H])C=2OC([H])(C([H])([H])[H])C([H])([H])[H])=O)C([H])([H])C1([H])[H])=O |
| Formula: | C35N6O5ClH35 |
| M.Wt: | 655.1426 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Imidazole ketone erastin (IKE) s a potent, selective, and metabolically stable inhibitor of the cystine-glutamate antiporter, system Xc- and an activator of ferroptosis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
