| Cas No.: | 2097853-86-4 |
| Chemical Name: | MLT-747 |
| Synonyms: | MLT-747;1-[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-3-[5-chloro-6-(pyrrolidine-1-carbonyl)pyridin-3-yl]urea;CID 129117094;Urea, N-[2-chloro-7-[(1S)-1-methoxyethyl]pyrazolo[1,5-a]pyrimidin-6-yl]-N'-[5-chloro-6-(1-pyrrolidinylcarbonyl)-3-pyridinyl]-;MLT747,MLT 747 |
| SMILES: | ClC1=CC(=CN=C1C(N1CCCC1)=O)NC(NC1C=NC2=CC(=NN2C=1[C@H](C)OC)Cl)=O |
| Formula: | C20H21Cl2N7O3 |
| M.Wt: | 478.331841230392 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MLT-747 (MLT747) is a potent, selective, allosteric inhibitor of MALT1 paracaspase with IC50 of 14 nM; binds MALT1 in the allosteric Trp580 pocket, reversibly binds and stabilizes human mutant MALT1-W580S in vitro and in MALT1mut/mut B cells, inhibits MALT1 peptide cleavage. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
