| Cas No.: | 116714-46-6 |
| Chemical Name: | Novaluron |
| Synonyms: | Novaluron;N-[[3-Chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]carbamoyl]-2,6-difluorobenzamide;Novaluron Solution;(RS)-1-[3-chloro-4-(1,1,2-trifluoro-2-trifluoromethoxyethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea;N-[[[3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]amino]carbonyl]-2,6-difluorobenzamide;rac-N-({3-chloro-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}carbamoyl)-2,6-difluorobenzamide;Rimon;Pedestal;Hsdb 7004;Oscar Super;Novaluron [iso];Diamond (insecticide);novaluron (bsi, pa e-iso);Novaluron Solution, 1000ppm |
| SMILES: | O=C(NC(NC1=CC=C(OC(F)(F)C(F)OC(F)(F)F)C(Cl)=C1)=O)C2=C(F)C=CC=C2F |
| Formula: | C17H9ClF8N2O4 |
| M.Wt: | 492.70 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Novaluron is a chemical with pesticide properties, belonging to the class of insecticides called insect growth regulators. |
| References: | [1]. Novaluron, From Wikipedia |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
