| Cas No.: | 183675-82-3 |
| Chemical Name: | Penthiopyrad |
| Synonyms: | 1-Ethyl-N-(2-(4-methylpentan-2-yl)thiophen-3-yl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide;N-[2-(1,3-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide;Penthiopyrad;MTF-753;(RS)-N-[2-(1,3-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide;1-methyl-N-[2-(4-methylpentan-2-yl)thiophen-3-yl]-3-(trifluoromethyl)pyrazole-4-carboxamide;N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3;rac-1-methyl-N-{2-[(2R)-4-methylpentan-2-yl]thiophen-3-yl}-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide;Penthiopyrad [iso] |
| SMILES: | O=C(C1=CN(C)N=C1C(F)(F)F)NC2=C(C(C)CC(C)C)SC=C2 |
| Formula: | C17H22N3OF3S |
| M.Wt: | 373.43628 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Penthiopyrad(MTF-753) is a carboxamide fungicide used to control a broad spectrum of diseases on large variety of corps; inhibits fungal respiration by binding to mitochondrial respiratory complex II. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
