| Cas No.: | 157009-81-9 |
| Chemical Name: | GPRP acetate |
| Synonyms: | GPRP (acetate);Glycyl-L-prolyl-L-arginyl-L-proline acetate;Gly-Pro-Arg-Pro acetate;Pefa 6003;Pefabloc FG;GPRP acetate;(S)-1-((S)-2-((S)-1-(2-aminoacetyl)pyrrolidine-2-carboxamido)-5-guanidinopentanoyl)pyrrolidine-2-carboxylic acid acetate;H-Gly-Pro-Arg-Pro-OH acetate |
| SMILES: | O=C([C@]([H])(C([H])([H])C([H])([H])C([H])([H])/N=C(\N([H])[H])/N([H])[H])N([H])C([C@]1([H])C([H])([H])C([H])([H])C([H])([H])N1C(C([H])([H])N([H])[H])=O)=O)N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(=O)O[H].O([H])C(C([H])([H])[H])=O |
| Formula: | C20H35N7O7 |
| M.Wt: | 485.5346 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | GPRP acetate is fibrinogen-related peptide, which inhibits the interaction of fibrinogen with the platelet membrane glycoprotein IIb/IIIa complex (GPIIb/IIIa). Sequence: Gly-Pro-Arg-Pro. |
| References: | [1]. Gallistl S, et al. Gly-pro-arg-pro (GPRP) enhances free thrombin. Thromb Res. 1995 Jun 15;78(6):547-50. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)