To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 3326-32-7 |
| Chemical Name: | 3',6'-dihydroxy-5-isothiocyanato-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one |
| Synonyms: | Fluorescein 5-isothiocyanate |
| SMILES: | O=C1C2C=C(N=C=S)C=CC=2C2(C3=CC=C(O)C=C3OC3C=C(O)C=CC2=3)O1 |
| Formula: | C21H11NO5S |
| M.Wt: | 389.3807 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | FITC is a derivative of fluorescein for the labeling of amines. |
| In Vitro: | Annexin V-FITC/PI is employed to detect chondrocyte apoptosis[1]. The PEI-modified CDs are conjugated with fluorescein isothiocyanate (FITC) to fabricate CDs-FITC composites[2]. |