| Cas No.: | 256922-53-9 |
| Chemical Name: | 2-propylthiazolo[4,5-c]quinolin-4-amine |
| Synonyms: | CL075;CL-075;3M002 |
| SMILES: | NC1=NC2=CC=CC=C2C(S3)=C1N=C3CCC |
| Formula: | C13H13N3S |
| M.Wt: | 243.33 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A selective TLR8 agonist that induces activation of NF-κB at 0.4 uM; induces similar cytokine profiles from human PBMC compared with TLR8 agonist ssRNA; effectively stimulates IL-12 production from mDC, but not pDC; induces TNF-α and IL-12 at 0.1 uM from monocytes and monocyte-derived DC (Mo-DC). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
