| Cas No.: | 252725-86-3 |
| Chemical Name: | Imidazo[1,2-a]pyrazin-3-amine, N-cyclohexyl-2-phenyl- |
| Synonyms: | Imidazo[1,2-a]pyrazin-3-amine, N-cyclohexyl-2-phenyl-;WAY-327512 |
| SMILES: | C12=NC(C3=CC=CC=C3)=C(NC3CCCCC3)N1C=CN=C2 |
| Formula: | C18H20N4 |
| M.Wt: | 292.378203392029 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
