| Cas No.: | 1079043-55-2 |
| Chemical Name: | Deudextromethorphan |
| Synonyms: | Avp-786;(9alpha,13alpha,14alpha)-3-(Methoxy-d3)-17-(methyl-d3)morphinan;Deudextromethorphan;d6-DM;427476LZFT;D6-Dextromethorphan;Deudextromethorphan [USAN];Deudextromethorphan (USAN/INN);D11152;C100003;Q27258502 |
| SMILES: | O(C([2H])([2H])[2H])C1C=CC2C[C@H]3[C@H]4CCCC[C@]4(C=2C=1)CCN3C([2H])([2H])[2H] |
| Formula: | C18H25NO |
| M.Wt: | 277.440 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Deudextromethorphan (AVP-786) is a deuterated form of dextromethorphan/quinidine (AVP-923, Nuedexta). Deudextromethorphan, a glutamate-targeting agent, is an orally active N-methyl-D-aspartate (NMDA) receptor antagonist. Deudextromethorphan can be used for the research of Pseudo-Bulbar Affect, traumatic brain injury, behavioral disinhibition and agitation in AD[1][2][3]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
