| Cas No.: | 1325307-57-0 |
| Synonyms: | Bz-Ile-Glu-Gly-Arg-pNA; Bz-Ile-Glu-Gly-Arg-p-nitroanilide; Factor Xa Chromogenic Substrate |
| SMILES: | O=C([C@H](CCCNC(N)=N)NC(CNC([C@@H](NC([C@](NC(C1=CC=CC=C1)=O)([H])[C@@H](C)CC)=O)CCC(O)=O)=O)=O)NC2=CC=C([N+]([O-])=O)C=C2.CC(O)=O |
| Formula: | C32H43N9O9.C2H4O2 |
| M.Wt: | 757.8 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Bz-IEGR-pNA is a colorimetric substrate for Factor Xa. |
| In Vitro: | Bz-IEGR-pNA is a colorimetric substrate for Factor Xa.Factor Xa preferentially binds to and cleaves the Ile-Glu-Gly-Arg (IEGR) peptide sequence to release p-nitroanilide (pNA), which can be quantified by colorimetric detection at 405 nm as a measure of Factor Xa activity. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
