| Cas No.: | 2231747-18-3 |
| Chemical Name: | N-Piperidine Ibrutinib (hydrochloride) |
| Synonyms: | N-piperidine Ibrutinib (hydrochloride);N-piperidine Ibrutinib hydrochloride |
| SMILES: | Cl[H].O(C1C([H])=C([H])C([H])=C([H])C=1[H])C1C([H])=C([H])C(=C([H])C=1[H])C1C2=C(N([H])[H])N=C([H])N=C2N(C2([H])C([H])([H])C([H])([H])N([H])C([H])([H])C2([H])[H])N=1 |
| Formula: | C22H23ClN6O |
| M.Wt: | 422.9106 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
