| Cas No.: | 882268-69-1 |
| Chemical Name: | HIF-2α-IN-4 |
| Synonyms: | HIF-2a Translation Inhibitor 76;HIF-2a translation inhibitor;HIF-2α-IN-4;Methyl 3-[[cyano(methylsulfonyl)methylene]hydrazinyl]-2-thiophenecarboxylate (ACI);HIF-2;882268-69-1;Methyl 3-(([cyano(methanesulfonyl)methylidene]amino)amino)thiophene-2-carboxylate;SR-01000635592-1;HY-136748;HIF-2alpha-IN-4;SCHEMBL781448;CCG-45847;MS-24103;A-IN-4;CS-0133535;methyl 3-[(2E)-2-[cyano(methylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate;DA-64162;methyl 3-(2-(cyano(methylsulfonyl)methylene)hydrazineyl)thiophene-2-carboxylate;HMS554D20 |
| SMILES: | N#CC(S(C)(=O)=O)=NNC1=C(C(OC)=O)SC=C1 |
| Formula: | C9H9N3O4S2 |
| M.Wt: | 287.315459012985 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
