| Cas No.: | 656830-24-9 |
| Chemical Name: | Antrodin A |
| Synonyms: | 2,5-Furandione,3-[4-[(3-methyl-2-butenyl)oxy]phenyl]-4-(2-methylpropyl)-;camphorataanhydride A;Antrodin A;ANTRODIN A;CAMPHORATA ANHYDRIDE A;2,5-Furandione, 3-[4-[(3-methyl-2-buten-1-yl)oxy]phenyl]-4-(2-methylpropyl)- |
| SMILES: | O=C(C(C1=CC=C(OC/C=C(C)/C)C=C1)=C2CC(C)C)OC2=O |
| Formula: | C19H22O4 |
| M.Wt: | 314.37558 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
