| Cas No.: | 921193-28-4 |
| Chemical Name: | Ethanol,2-[2-[2-[2-[[4-(6-methyl-2-benzothiazolyl)phenyl]amino]ethoxy]ethoxy]ethoxy]- |
| Synonyms: | Ethanol,2-[2-[2-[2-[[4-(6-methyl-2-benzothiazolyl)phenyl]amino]ethoxy]ethoxy]ethoxy]- |
| SMILES: | N(C1C=CC(C2SC3=CC(C)=CC=C3N=2)=CC=1)CCOCCOCCOCCO |
| Formula: | C22H28N2O4S |
| M.Wt: | 416.533724784851 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | A tetra(ethylene glycol) derivative of benzothiazole aniline enhances Ras-mediated spinogenesis.PMID: 24316432 PMCID: PMC4861143 DOI: 10.1016/j.expneurol.2013.11.023 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.gif)