| Cas No.: | 2505339-87-5 |
| Chemical Name: | (S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-(4-cyanobenzyl)thiazole-4-carboxamide |
| Synonyms: | BR103354; BR 103354; BR-103354; |
| SMILES: | O=C(C1=CSC(CC2=CC=C(C#N)C=C2)=N1)NCC(N3[C@H](C#N)CC(F)(F)C3)=O |
| Formula: | C19H15F2N5O2S |
| M.Wt: | 415.4188 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BR103354 is a novel fibroblast activation protein (FAP) inhibitor with anti-diabetic and anti-steatotic effects. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
