| Cas No.: | 2484739-25-3 |
| Chemical Name: | 5H-Pyrazolo[4,3-c]pyridine-5-carboxamide, 3-[7-(difluoromethyl)-3,4-dihydro-6-(1-methyl-1Hpyrazol-4-yl)-1(2H)-quinolinyl]-1-[1-[15-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-5-yl]amino]-1-oxo-4,7,10,13-tetraoxapentadec-1-yl]-4-piperid |
| Synonyms: | dCBP-1; dCBP 1; dCBP1; |
| SMILES: | O=C(N1CCC(N(C2CCN(C(CCOCCOCCOCCOCCNC3=CC4=C(C(N(C(CC5)C(NC5=O)=O)C4=O)=O)C=C3)=O)CC2)N=C6N7CCCC8=C7C=C(C(F)F)C(C9=CN(C)N=C9)=C8)=C6C1)NC |
| Formula: | C51H63F2N11O10 |
| M.Wt: | 1027.4727 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
