| Cas No.: | 126766-43-6 |
| Chemical Name: | (R)-Methyl 4-(2-(3,4-dichlorophenyl)acetyl)-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate fumarate |
| Synonyms: | (R)-Methyl 4-(2-(3,4-dichlorophenyl)acetyl)-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate fumarate;(R)-(-)-GR103545 fumarate |
| SMILES: | C(/C(=O)O)=C\C(=O)O.C(N1CCN(C(=O)OC)C[C@H]1CN1CCCC1)(=O)CC1C=CC(Cl)=C(Cl)C=1 |
| Formula: | C23H29Cl2N3O7 |
| M.Wt: | 530.399 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
