| Cas No.: | 2376328-55-9 |
| Chemical Name: | K-Ras G12C-IN-4 |
| Synonyms: | K-Ras G12C-IN-4 |
| SMILES: | O=C(NC1CN(C(C=C)=O)C1)CN2C(C3CC3)=C(C(N4CC5=C(C(OC)=CC=C5)CC4)=O)C6=C2C(C)=CC(Cl)=C6 |
| Formula: | C31H33ClN4O4 |
| M.Wt: | 561.07 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | K-Ras G12C-IN-4, compound 1, is a potent Covalent Inhibitor of KRASG12C[1]. |
| In Vitro: | K-Ras G12C-IN-4 (4 hours) exhibits IC50=0.219 μM for inhibition of MAPK signaling (p-ERK) in MIA PaCa-2 cells[1]. K-Ras G12C-IN-4 (72 hours) translates to a 0.067 μM IC50 for inhibition of cellular viability in a CellTiter-Glo experiment in MIA PaCa-2 cells[1]. |
| References: | K-Ras G12C-IN-4 (4 hours) exhibits IC50=0.219 μM for inhibition of MAPK signaling (p-ERK) in MIA PaCa-2 cells[1]. K-Ras G12C-IN-4 (72 hours) translates to a 0.067 μM IC50 for inhibition of cellular viability in a CellTiter-Glo experiment in MIA PaCa-2 cells[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
