| Cas No.: | 423128-55-6 |
| Chemical Name: | RUVBL1/2 ATPase-IN-1 |
| SMILES: | O=C(C1=C2N=C(C)C(CC3=CC=C(C)C=C3)=C(C)N2N=C1)N4CCN(C5=CC=CC(C(F)(F)F)=C5)CC4 |
| Formula: | C28H28F3N5O |
| M.Wt: | 507.55 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | RUVBL1/2 ATPase-IN-1 (compound 18) is a potent and selective inhibitor of RUVBL1/2 ATPase with IC50 values of 6.0 and 7.7 μM, respectively. RUVBL1 and RUVBL2 are highly conserved AAA ATPases (ATPases Associated with various cellular Activities) and highly relevant to the progression of cancer. RUVBL1/2 ATPase-IN-1 has the potential for the research of cancer diseases. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
