| Cas No.: | 932730-52-4 |
| Chemical Name: | (4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(2,2,2-trifluoroethyl)-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxamide |
| Synonyms: | CDDO-TFEA, 4;BDBM217381;(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-N-(2,2,2-trifluo |
| SMILES: | FC(CNC([C@]12CCC(C)(C)C[C@H]1[C@H]1C(C=C3[C@]4(C=C(C#N)C(C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2)=O)C)=O)=O)(F)F |
| Formula: | C33H43F3N2O3 |
| M.Wt: | 572.701339960098 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)