| Cas No.: | 478482-74-5 |
| Chemical Name: | Pyridine, 4-[5-[[(2-chlorophenyl)methyl]thio]-1,3,4-oxadiazol-2-yl]- |
| Synonyms: | Pyridine, 4-[5-[[(2-chlorophenyl)methyl]thio]-1,3,4-oxadiazol-2-yl]- |
| SMILES: | ClC1=CC=CC=C1CSC1OC(C2=CC=NC=C2)=NN=1 |
| Formula: | C14H10N3Oscl |
| M.Wt: | 303.767 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK3-IN-1 (compound 11) is a GSK-3 inhibitor with an IC50 value of 12 μM. GSK3-IN-1 can be used in the research of diabetes[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
