| Cas No.: | 291528-35-3 |
| SMILES: | O=C(O)C1=CC=C(NC2CC2)C([N+]([O-])=O)=C1 |
| Formula: | C10H10N2O4 |
| M.Wt: | 222.197 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | WAY-622024(Compound 5j) is a GPCR GPR109b (HM74) agonist, with a pEC50 value of 6.51. GPCR agonist-2 can be used for research of lipid disorders. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
